C15H16FNO3 — CID 81362073
1-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 81362073) has the molecular formula C15H16FNO3 and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81362073 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccccc1F)NCC1(C(=O)O)CCC1 |
| InChI | InChI=1S/C15H16FNO3/c16-12-5-2-1-4-11(12)6-7-13(18)17-10-15(14(19)20)8-3-9-15/h1-2,4-7H,3,8-10H2,(H,17,18)(H,19,20)/b7-6+ |
| InChIKey | MHSQJRZHGUIHGI-VOTSOKGWSA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|