C21H30O3 — CID 171562780
9a-(3,4-dimethoxyphenyl)-4,5-dimethyl-2,4,4a,5,6,7,8,9-octahydro-1H-benzo[7]annulen-3-one (PubChem CID 171562780) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 9a-(3,4-dimethoxyphenyl)-4,5-dimethyl-2,4,4a,5,6,7,8,9-octahydro-1H-benzo[7]annulen-3-one.
| Compound Name | 9a-(3,4-dimethoxyphenyl)-4,5-dimethyl-2,4,4a,5,6,7,8,9-octahydro-1H-benzo[7]annulen-3-one |
|---|---|
| PubChem CID | 171562780 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 9a-(3,4-dimethoxyphenyl)-4,5-dimethyl-2,4,4a,5,6,7,8,9-octahydro-1H-benzo[7]annulen-3-one |
| SMILES | COc1ccc(C23CCCCC(C)C2C(C)C(=O)CC3)cc1OC |
| InChI | InChI=1S/C21H30O3/c1-14-7-5-6-11-21(12-10-17(22)15(2)20(14)21)16-8-9-18(23-3)19(13-16)24-4/h8-9,13-15,20H,5-7,10-12H2,1-4H3 |
| InChIKey | GODGANMODXPKBK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |