C17H23NO2 — CID 54250759
(1R,9R,10R)-5-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 54250759) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (1R,9R,10R)-5-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-5-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 54250759 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (1R,9R,10R)-5-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | COc1cc2c(cc1O)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C17H23NO2/c1-20-16-9-11-8-14-12-4-2-3-5-17(12,6-7-18-14)13(11)10-15(16)19/h9-10,12,14,18-19H,2-8H2,1H3/t12-,14+,17+/m0/s1 |
| InChIKey | QWOFAYOLCLFQIS-DXCKQFNASA-N |
| XLogP | 2.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |