C19H24F3NO4 — CID 50914784
(1S,9S,10S)-5-(hydroxymethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid (PubChem CID 50914784) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is (1S,9S,10S)-5-(hydroxymethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,9S,10S)-5-(hydroxymethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 50914784 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (1S,9S,10S)-5-(hydroxymethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OCc1cc2c(cc1O)[C@]13CCCC[C@@H]1[C@H](C2)NCC3 |
| InChI | InChI=1S/C17H23NO2.C2HF3O2/c19-10-12-7-11-8-15-13-3-1-2-4-17(13,5-6-18-15)14(11)9-16(12)20;3-2(4,5)1(6)7/h7,9,13,15,18-20H,1-6,8,10H2;(H,6,7)/t13-,15+,17+;/m1./s1 |
| InChIKey | UNOBDENWFDHBFG-GGKYQYESSA-N |
| XLogP | 2.86 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |