C24H28F3N3O2 — CID 159010235
(1S,9S,10S)-5-(4-aminoanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde (PubChem CID 159010235) has the molecular formula C24H28F3N3O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is (1S,9S,10S)-5-(4-aminoanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde.
| Compound Name | (1S,9S,10S)-5-(4-aminoanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159010235 |
| Molecular Formula | C24H28F3N3O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | (1S,9S,10S)-5-(4-aminoanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde |
| SMILES | Nc1ccc(Nc2cc3c(cc2O)[C@]24CCCC[C@@H]2[C@H](C3)NCC4)cc1.O=CC(F)(F)F |
| InChI | InChI=1S/C22H27N3O.C2HF3O/c23-15-4-6-16(7-5-15)25-20-12-14-11-19-17-3-1-2-8-22(17,9-10-24-19)18(14)13-21(20)26;3-2(4,5)1-6/h4-7,12-13,17,19,24-26H,1-3,8-11,23H2;1H/t17-,19+,22+;/m1./s1 |
| InChIKey | JSJWDKQDARTFJF-VCPFRWFZSA-N |
| XLogP | 4.81 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|