C24H25F3N2O2 — CID 158927695
(1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7,9,11,13-hexaen-4-ol;2,2,2-trifluoroacetaldehyde (PubChem CID 158927695) has the molecular formula C24H25F3N2O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is (1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7,9,11,13-hexaen-4-ol;2,2,2-trifluoroacetaldehyde.
| Compound Name | (1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7,9,11,13-hexaen-4-ol;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158927695 |
| Molecular Formula | C24H25F3N2O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7,9,11,13-hexaen-4-ol;2,2,2-trifluoroacetaldehyde |
| SMILES | O=CC(F)(F)F.Oc1cc2c(c3c1[nH]c1ccccc13)C[C@@H]1NCC[C@]23CCCC[C@H]13 |
| InChI | InChI=1S/C22H24N2O.C2HF3O/c25-19-12-16-14(20-13-5-1-2-7-17(13)24-21(19)20)11-18-15-6-3-4-8-22(15,16)9-10-23-18;3-2(4,5)1-6/h1-2,5,7,12,15,18,23-25H,3-4,6,8-11H2;1H/t15-,18+,22+;/m1./s1 |
| InChIKey | JIQLYMXNNZERSL-FXWMAGKJSA-N |
| XLogP | 5.12 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|