C27H28F3N3O3 — CID 50913908
(1S,9S,10S)-5-(quinolin-6-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid (PubChem CID 50913908) has the molecular formula C27H28F3N3O3 and a molecular weight of 499.53 g/mol. Its IUPAC name is (1S,9S,10S)-5-(quinolin-6-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,9S,10S)-5-(quinolin-6-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 50913908 |
| Molecular Formula | C27H28F3N3O3 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | (1S,9S,10S)-5-(quinolin-6-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.Oc1cc2c(cc1Nc1ccc3ncccc3c1)C[C@@H]1NCC[C@]23CCCC[C@H]13 |
| InChI | InChI=1S/C25H27N3O.C2HF3O2/c29-24-15-20-17(13-22-19-5-1-2-8-25(19,20)9-11-27-22)14-23(24)28-18-6-7-21-16(12-18)4-3-10-26-21;3-2(4,5)1(6)7/h3-4,6-7,10,12,14-15,19,22,27-29H,1-2,5,8-9,11,13H2;(H,6,7)/t19-,22+,25+;/m1./s1 |
| InChIKey | NJYWCPINUPYFFX-CNRKIQCYSA-N |
| XLogP | 5.66 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|