C24H25F3N2O3 — CID 158001814
(1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7(12),8,10,13-hexaene-4,10-diol;2,2,2-trifluoroacetaldehyde (PubChem CID 158001814) has the molecular formula C24H25F3N2O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is (1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7(12),8,10,13-hexaene-4,10-diol;2,2,2-trifluoroacetaldehyde.
| Compound Name | (1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7(12),8,10,13-hexaene-4,10-diol;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158001814 |
| Molecular Formula | C24H25F3N2O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (1S,16S,17S)-6,24-diazahexacyclo[14.5.3.01,17.02,14.05,13.07,12]tetracosa-2,4,7(12),8,10,13-hexaene-4,10-diol;2,2,2-trifluoroacetaldehyde |
| SMILES | O=CC(F)(F)F.Oc1ccc2[nH]c3c(O)cc4c(c3c2c1)C[C@@H]1NCC[C@]42CCCC[C@H]12 |
| InChI | InChI=1S/C22H24N2O2.C2HF3O/c25-12-4-5-17-14(9-12)20-13-10-18-15-3-1-2-6-22(15,7-8-23-18)16(13)11-19(26)21(20)24-17;3-2(4,5)1-6/h4-5,9,11,15,18,23-26H,1-3,6-8,10H2;1H/t15-,18+,22+;/m1./s1 |
| InChIKey | FDVAAXVNPQEUCH-FXWMAGKJSA-N |
| XLogP | 4.83 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|