C22H29F3N2O2 — CID 161068856
(1S,9S,10S)-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde (PubChem CID 161068856) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is (1S,9S,10S)-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde.
| Compound Name | (1S,9S,10S)-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161068856 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (1S,9S,10S)-5-pyrrolidin-1-yl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde |
| SMILES | O=CC(F)(F)F.Oc1cc2c(cc1N1CCCC1)C[C@@H]1NCC[C@]23CCCC[C@H]13 |
| InChI | InChI=1S/C20H28N2O.C2HF3O/c23-19-13-16-14(12-18(19)22-9-3-4-10-22)11-17-15-5-1-2-6-20(15,16)7-8-21-17;3-2(4,5)1-6/h12-13,15,17,21,23H,1-11H2;1H/t15-,17+,20+;/m1./s1 |
| InChIKey | UEJVNMXNTOVHMR-IAAVHTRPSA-N |
| XLogP | 4.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|