C21H31N3O — CID 123488289
(1R,9R,10R)-5-(4-methylpiperazin-1-yl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 123488289) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (1R,9R,10R)-5-(4-methylpiperazin-1-yl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-5-(4-methylpiperazin-1-yl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 123488289 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (1R,9R,10R)-5-(4-methylpiperazin-1-yl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | CN1CCN(c2cc3c(cc2O)[C@@]24CCCC[C@H]2[C@@H](C3)NCC4)CC1 |
| InChI | InChI=1S/C21H31N3O/c1-23-8-10-24(11-9-23)19-13-15-12-18-16-4-2-3-5-21(16,6-7-22-18)17(15)14-20(19)25/h13-14,16,18,22,25H,2-12H2,1H3/t16-,18+,21+/m0/s1 |
| InChIKey | GUPFUZXALGVOLP-YRISNDGFSA-N |
| XLogP | 2.49 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |