C25H27F3N2O4 — CID 158060415
(1S,9S,10S)-5-(1,3-benzodioxol-5-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde (PubChem CID 158060415) has the molecular formula C25H27F3N2O4 and a molecular weight of 476.50 g/mol. Its IUPAC name is (1S,9S,10S)-5-(1,3-benzodioxol-5-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde.
| Compound Name | (1S,9S,10S)-5-(1,3-benzodioxol-5-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158060415 |
| Molecular Formula | C25H27F3N2O4 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (1S,9S,10S)-5-(1,3-benzodioxol-5-ylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol;2,2,2-trifluoroacetaldehyde |
| SMILES | O=CC(F)(F)F.Oc1cc2c(cc1Nc1ccc3c(c1)OCO3)C[C@@H]1NCC[C@]23CCCC[C@H]13 |
| InChI | InChI=1S/C23H26N2O3.C2HF3O/c26-20-12-17-14(9-18-16-3-1-2-6-23(16,17)7-8-24-18)10-19(20)25-15-4-5-21-22(11-15)28-13-27-21;3-2(4,5)1-6/h4-5,10-12,16,18,24-26H,1-3,6-9,13H2;1H/t16-,18+,23+;/m1./s1 |
| InChIKey | FKOOBVFAONTMTM-VTGQEPGKSA-N |
| XLogP | 4.96 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|