C17H25NO3 — CID 176592115
(3aS,6S,7aS)-3a-[3,4-bis(trideuteriomethoxy)phenyl]-1-(trideuteriomethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 176592115) has the molecular formula C17H25NO3 and a molecular weight of 300.45 g/mol. Its IUPAC name is (3aS,6S,7aS)-3a-[3,4-bis(trideuteriomethoxy)phenyl]-1-(trideuteriomethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aS,6S,7aS)-3a-[3,4-bis(trideuteriomethoxy)phenyl]-1-(trideuteriomethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 176592115 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | (3aS,6S,7aS)-3a-[3,4-bis(trideuteriomethoxy)phenyl]-1-(trideuteriomethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | [2H]C([2H])([2H])Oc1ccc([C@@]23CC[C@H](O)C[C@@H]2N(C([2H])([2H])[2H])CC3)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C17H25NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10,13,16,19H,6-9,11H2,1-3H3/t13-,16-,17-/m0/s1/i1D3,2D3,3D3 |
| InChIKey | KPMLOZVRLWHOBN-JLTICIKSSA-N |
| XLogP | 2.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |