C18H24FNO2 — CID 177037134
(3aS,7aS)-3a-(3-fluoro-4,5-dimethoxyphenyl)-1-methyl-6-methylidene-2,3,4,5,7,7a-hexahydroindole (PubChem CID 177037134) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is (3aS,7aS)-3a-(3-fluoro-4,5-dimethoxyphenyl)-1-methyl-6-methylidene-2,3,4,5,7,7a-hexahydroindole.
| Compound Name | (3aS,7aS)-3a-(3-fluoro-4,5-dimethoxyphenyl)-1-methyl-6-methylidene-2,3,4,5,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 177037134 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3aS,7aS)-3a-(3-fluoro-4,5-dimethoxyphenyl)-1-methyl-6-methylidene-2,3,4,5,7,7a-hexahydroindole |
| SMILES | C=C1CC[C@@]2(c3cc(F)c(OC)c(OC)c3)CCN(C)[C@H]2C1 |
| InChI | InChI=1S/C18H24FNO2/c1-12-5-6-18(7-8-20(2)16(18)9-12)13-10-14(19)17(22-4)15(11-13)21-3/h10-11,16H,1,5-9H2,2-4H3/t16-,18-/m0/s1 |
| InChIKey | BEPIPTWXTNDWTF-WMZOPIPTSA-N |
| XLogP | 3.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|