C16H24N2O2 — CID 177061402
(3aR,7aR)-3a-(5,6-dimethoxy-3-pyridinyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 177061402) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3aR,7aR)-3a-(5,6-dimethoxy-3-pyridinyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,7aR)-3a-(5,6-dimethoxy-3-pyridinyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 177061402 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3aR,7aR)-3a-(5,6-dimethoxy-3-pyridinyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1cc([C@]23CCCC[C@H]2N(C)CC3)cnc1OC |
| InChI | InChI=1S/C16H24N2O2/c1-18-9-8-16(7-5-4-6-14(16)18)12-10-13(19-2)15(20-3)17-11-12/h10-11,14H,4-9H2,1-3H3/t14-,16-/m1/s1 |
| InChIKey | BUTAPELVCLQNBE-GDBMZVCRSA-N |
| XLogP | 2.61 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |