C17H25N4+ — CID 177061411
6-[(3aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-1,3-dimethylimidazo[4,5-b]pyridin-3-ium (PubChem CID 177061411) has the molecular formula C17H25N4+ and a molecular weight of 285.42 g/mol. Its IUPAC name is 6-[(3aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-1,3-dimethylimidazo[4,5-b]pyridin-3-ium.
| Compound Name | 6-[(3aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-1,3-dimethylimidazo[4,5-b]pyridin-3-ium |
|---|---|
| PubChem CID | 177061411 |
| Molecular Formula | C17H25N4+ |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 6-[(3aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-1,3-dimethylimidazo[4,5-b]pyridin-3-ium |
| SMILES | CN1CC[C@]2(c3cnc4c(c3)n(C)c[n+]4C)CCCCC12 |
| InChI | InChI=1S/C17H25N4/c1-19-9-8-17(7-5-4-6-15(17)19)13-10-14-16(18-11-13)21(3)12-20(14)2/h10-12,15H,4-9H2,1-3H3/q+1/t15?,17-/m0/s1 |
| InChIKey | WQKCOHZJJLCOGN-LWKPJOBUSA-N |
| XLogP | 1.91 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|