C17H22F2N2O — CID 177061504
6-[(3aS,7aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-2,2-difluoro-3-methyl-1,3-benzoxazole (PubChem CID 177061504) has the molecular formula C17H22F2N2O and a molecular weight of 308.37 g/mol. Its IUPAC name is 6-[(3aS,7aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-2,2-difluoro-3-methyl-1,3-benzoxazole.
| Compound Name | 6-[(3aS,7aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-2,2-difluoro-3-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 177061504 |
| Molecular Formula | C17H22F2N2O |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-[(3aS,7aS)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-3a-yl]-2,2-difluoro-3-methyl-1,3-benzoxazole |
| SMILES | CN1CC[C@]2(c3ccc4c(c3)OC(F)(F)N4C)CCCC[C@H]12 |
| InChI | InChI=1S/C17H22F2N2O/c1-20-10-9-16(8-4-3-5-15(16)20)12-6-7-13-14(11-12)22-17(18,19)21(13)2/h6-7,11,15H,3-5,8-10H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | SSAAIUMWXBNVGO-HOTGVXAUSA-N |
| XLogP | 3.58 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|