C22H25NO4S — CID 134960354
(3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 134960354) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is (3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 134960354 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@]3(c4ccc5c(c4)OCO5)CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-16-5-8-18(9-6-16)28(24,25)23-13-12-22(11-3-2-4-21(22)23)17-7-10-19-20(14-17)27-15-26-19/h5-10,14,21H,2-4,11-13,15H2,1H3/t21-,22-/m0/s1 |
| InChIKey | XJAPMOGUXYGPQJ-VXKWHMMOSA-N |
| XLogP | 4.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |