C17H25NO2S — CID 10063837
(3R,3aR,7aR)-3,3a-dimethyl-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 10063837) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (3R,3aR,7aR)-3,3a-dimethyl-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3R,3aR,7aR)-3,3a-dimethyl-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 10063837 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (3R,3aR,7aR)-3,3a-dimethyl-1-(4-methylphenyl)sulfonyl-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C)[C@@]3(C)CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C17H25NO2S/c1-13-7-9-15(10-8-13)21(19,20)18-12-14(2)17(3)11-5-4-6-16(17)18/h7-10,14,16H,4-6,11-12H2,1-3H3/t14-,16+,17+/m0/s1 |
| InChIKey | ZVJFVERHGXUKSH-USXIJHARSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |