C19H30N2O4SSi — CID 11486686
[(3aS,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-[1,2]oxazolo[4,3-c]indol-1-yl]oxy-trimethylsilane (PubChem CID 11486686) has the molecular formula C19H30N2O4SSi and a molecular weight of 410.61 g/mol. Its IUPAC name is [(3aS,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-[1,2]oxazolo[4,3-c]indol-1-yl]oxy-trimethylsilane.
| Compound Name | [(3aS,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-[1,2]oxazolo[4,3-c]indol-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11486686 |
| Molecular Formula | C19H30N2O4SSi |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [(3aS,9aS)-5-(4-methylphenyl)sulfonyl-3,3a,4,5a,6,7,8,9-octahydro-[1,2]oxazolo[4,3-c]indol-1-yl]oxy-trimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CON(O[Si](C)(C)C)[C@@]34CCCCC24)cc1 |
| InChI | InChI=1S/C19H30N2O4SSi/c1-15-8-10-17(11-9-15)26(22,23)20-13-16-14-24-21(25-27(2,3)4)19(16)12-6-5-7-18(19)20/h8-11,16,18H,5-7,12-14H2,1-4H3/t16-,18?,19+/m1/s1 |
| InChIKey | IYCXCGXICHDJKA-WDOSNPKHSA-N |
| XLogP | 3.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|