C13H17NO2S — CID 125495258
(1R,5R)-1-methyl-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane (PubChem CID 125495258) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (1R,5R)-1-methyl-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane.
| Compound Name | (1R,5R)-1-methyl-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 125495258 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (1R,5R)-1-methyl-6-(4-methylphenyl)sulfonyl-6-azabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3CCC[C@]32C)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-10-5-7-11(8-6-10)17(15,16)14-12-4-3-9-13(12,14)2/h5-8,12H,3-4,9H2,1-2H3/t12-,13-,14?/m1/s1 |
| InChIKey | WLCFWHDMHJVJOU-ZFXTZCCVSA-N |
| XLogP | 2.31 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|