C13H16N2O2S — CID 134896823
3-ethyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonitrile (PubChem CID 134896823) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-ethyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonitrile.
| Compound Name | 3-ethyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonitrile |
|---|---|
| PubChem CID | 134896823 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-ethyl-2-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carbonitrile |
| SMILES | CCC1N(S(=O)(=O)c2ccc(C)cc2)C1(C)C#N |
| InChI | InChI=1S/C13H16N2O2S/c1-4-12-13(3,9-14)15(12)18(16,17)11-7-5-10(2)6-8-11/h5-8,12H,4H2,1-3H3 |
| InChIKey | RHLZAIOCLYFRSW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|