C15H23NO3S — CID 102507295
[(2S,3R)-3-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol (PubChem CID 102507295) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is [(2S,3R)-3-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol.
| Compound Name | [(2S,3R)-3-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol |
|---|---|
| PubChem CID | 102507295 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(2S,3R)-3-butyl-2-methyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]methanol |
| SMILES | CCCC[C@H]1N(S(=O)(=O)c2ccc(C)cc2)[C@]1(C)CO |
| InChI | InChI=1S/C15H23NO3S/c1-4-5-6-14-15(3,11-17)16(14)20(18,19)13-9-7-12(2)8-10-13/h7-10,14,17H,4-6,11H2,1-3H3/t14-,15-,16?/m1/s1 |
| InChIKey | GHQCOFXHUTWPFX-YGFGXBMJSA-N |
| XLogP | 2.31 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|