About cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid
cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid (PubChem CID 87839884) has the molecular formula C12H19N2O3S+
and a molecular weight of 271.36 g/mol. Its IUPAC name is cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid |
| PubChem CID | 87839884 |
| Molecular Formula | C12H19N2O3S+ |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid |
| SMILES | C[N+](C)(C)CC#N.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C5H11N2/c1-6-2-4-7(5-3-6)11(8,9)10;1-7(2,3)5-4-6/h2-5H,1H3,(H,8,9,10);5H2,1-3H3/q;+1 |
| InChIKey | ZRGIFOUVFVUHJR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid?
The IUPAC name of cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid (CID 87839884) is cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid.
What is the SMILES notation for cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid?
The canonical SMILES for cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid is C[N+](C)(C)CC#N.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid?
The InChIKey is ZRGIFOUVFVUHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C5H11N2/c1-6-2-4-7(5-3-6)11(8,9)10;1-7(2,3)5-4-6/h2-5H,1H3,(H,8,9,10);5H2,1-3H3/q;+1.
What are the key properties of cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid?
cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid has a molecular weight of 271.36 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl(trimethyl)azanium;4-methylbenzenesulfonic acid is sourced from PubChem (CID 87839884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).