C13H24NO5S+ — CID 57483597
bis(2-hydroxyethyl)-dimethylazanium;4-methylbenzenesulfonic acid (PubChem CID 57483597) has the molecular formula C13H24NO5S+ and a molecular weight of 306.40 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-dimethylazanium;4-methylbenzenesulfonic acid.
| Compound Name | bis(2-hydroxyethyl)-dimethylazanium;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 57483597 |
| Molecular Formula | C13H24NO5S+ |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | bis(2-hydroxyethyl)-dimethylazanium;4-methylbenzenesulfonic acid |
| SMILES | C[N+](C)(CCO)CCO.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C6H16NO2/c1-6-2-4-7(5-3-6)11(8,9)10;1-7(2,3-5-8)4-6-9/h2-5H,1H3,(H,8,9,10);8-9H,3-6H2,1-2H3/q;+1 |
| InChIKey | ITJAENNXRUUNGP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|