C22H24N2O3S — CID 134947328
(2S,3S)-3-ethyl-2-(4-methoxyphenyl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile (PubChem CID 134947328) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S,3S)-3-ethyl-2-(4-methoxyphenyl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile.
| Compound Name | (2S,3S)-3-ethyl-2-(4-methoxyphenyl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 134947328 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2S,3S)-3-ethyl-2-(4-methoxyphenyl)-4-methylidene-1-(4-methylphenyl)sulfonylpyrrolidine-3-carbonitrile |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccc(OC)cc2)[C@]1(C#N)CC |
| InChI | InChI=1S/C22H24N2O3S/c1-5-22(15-23)17(3)14-24(21(22)18-8-10-19(27-4)11-9-18)28(25,26)20-12-6-16(2)7-13-20/h6-13,21H,3,5,14H2,1-2,4H3/t21-,22-/m0/s1 |
| InChIKey | FNONASQWRGEGFD-VXKWHMMOSA-N |
| XLogP | 4.23 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|