C17H19NO3S2 — CID 2858670
2-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 2858670) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 2858670 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H19NO3S2/c1-13-3-9-16(10-4-13)23(19,20)18-11-12-22-17(18)14-5-7-15(21-2)8-6-14/h3-10,17H,11-12H2,1-2H3 |
| InChIKey | GCQDBYMCNWRYGI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |