C14H15NO4S2 — CID 1084382
(2S)-2-(furan-2-yl)-3-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 1084382) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S)-2-(furan-2-yl)-3-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2S)-2-(furan-2-yl)-3-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 1084382 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (2S)-2-(furan-2-yl)-3-(4-methoxyphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCS[C@H]2c2ccco2)cc1 |
| InChI | InChI=1S/C14H15NO4S2/c1-18-11-4-6-12(7-5-11)21(16,17)15-8-10-20-14(15)13-3-2-9-19-13/h2-7,9,14H,8,10H2,1H3/t14-/m0/s1 |
| InChIKey | GPOKOHIDPJJOOC-AWEZNQCLSA-N |
| XLogP | 2.72 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |