C23H23NO5S2 — CID 122345675
2-(3,4-dimethoxyphenyl)-3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 122345675) has the molecular formula C23H23NO5S2 and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 122345675 |
| Molecular Formula | C23H23NO5S2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-(4-phenoxyphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2ccc(Oc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C23H23NO5S2/c1-27-21-13-8-17(16-22(21)28-2)23-24(14-15-30-23)31(25,26)20-11-9-19(10-12-20)29-18-6-4-3-5-7-18/h3-13,16,23H,14-15H2,1-2H3 |
| InChIKey | GRKZGSAFRIRAHM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |