C21H21NO4S2 — CID 1111413
(2S)-2-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylsulfonyl-1,3-thiazolidine (PubChem CID 1111413) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylsulfonyl-1,3-thiazolidine.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylsulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 1111413 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-3-naphthalen-2-ylsulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc([C@@H]2SCCN2S(=O)(=O)c2ccc3ccccc3c2)cc1OC |
| InChI | InChI=1S/C21H21NO4S2/c1-25-19-10-8-17(14-20(19)26-2)21-22(11-12-27-21)28(23,24)18-9-7-15-5-3-4-6-16(15)13-18/h3-10,13-14,21H,11-12H2,1-2H3/t21-/m0/s1 |
| InChIKey | FFAUIISTKPUCHT-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |