C19H17NO2S2 — CID 2848104
3-naphthalen-2-ylsulfonyl-2-phenyl-1,3-thiazolidine (PubChem CID 2848104) has the molecular formula C19H17NO2S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-naphthalen-2-ylsulfonyl-2-phenyl-1,3-thiazolidine.
| Compound Name | 3-naphthalen-2-ylsulfonyl-2-phenyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 2848104 |
| Molecular Formula | C19H17NO2S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-naphthalen-2-ylsulfonyl-2-phenyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCSC1c1ccccc1 |
| InChI | InChI=1S/C19H17NO2S2/c21-24(22,18-11-10-15-6-4-5-9-17(15)14-18)20-12-13-23-19(20)16-7-2-1-3-8-16/h1-11,14,19H,12-13H2 |
| InChIKey | YPAZQFTVOPSKOW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |