C14H14N2O2S2 — CID 3681206
3-(benzenesulfonyl)-2-pyridin-4-yl-1,3-thiazolidine (PubChem CID 3681206) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-pyridin-4-yl-1,3-thiazolidine.
| Compound Name | 3-(benzenesulfonyl)-2-pyridin-4-yl-1,3-thiazolidine |
|---|---|
| PubChem CID | 3681206 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-(benzenesulfonyl)-2-pyridin-4-yl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccccc1)N1CCSC1c1ccncc1 |
| InChI | InChI=1S/C14H14N2O2S2/c17-20(18,13-4-2-1-3-5-13)16-10-11-19-14(16)12-6-8-15-9-7-12/h1-9,14H,10-11H2 |
| InChIKey | ZUOMSDBIMVSTNT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |