C21H18ClNO2S2 — CID 7574021
(2R)-2-(3-chlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 7574021) has the molecular formula C21H18ClNO2S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2R)-2-(3-chlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 7574021 |
| Molecular Formula | C21H18ClNO2S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (2R)-2-(3-chlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc(-c2ccccc2)cc1)N1CCS[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H18ClNO2S2/c22-19-8-4-7-18(15-19)21-23(13-14-26-21)27(24,25)20-11-9-17(10-12-20)16-5-2-1-3-6-16/h1-12,15,21H,13-14H2/t21-/m1/s1 |
| InChIKey | XKCHFFKDLOQQQN-OAQYLSRUSA-N |
| XLogP | 5.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |