C15H13ClINO2S2 — CID 41316900
(2S)-2-(3-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 41316900) has the molecular formula C15H13ClINO2S2 and a molecular weight of 465.77 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2S)-2-(3-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 41316900 |
| Molecular Formula | C15H13ClINO2S2 |
| Molecular Weight | 465.77 g/mol |
| Exact Mass | 464.91 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc(I)cc1)N1CCS[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClINO2S2/c16-12-3-1-2-11(10-12)15-18(8-9-21-15)22(19,20)14-6-4-13(17)5-7-14/h1-7,10,15H,8-9H2/t15-/m0/s1 |
| InChIKey | WNRCNCQQBRZYKS-HNNXBMFYSA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|