C16H15BrINO3S2 — CID 98128921
(2R)-2-(3-bromo-4-methoxyphenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 98128921) has the molecular formula C16H15BrINO3S2 and a molecular weight of 540.24 g/mol. Its IUPAC name is (2R)-2-(3-bromo-4-methoxyphenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2R)-2-(3-bromo-4-methoxyphenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 98128921 |
| Molecular Formula | C16H15BrINO3S2 |
| Molecular Weight | 540.24 g/mol |
| Exact Mass | 538.87 |
| IUPAC Name | (2R)-2-(3-bromo-4-methoxyphenyl)-3-(4-iodophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc([C@H]2SCCN2S(=O)(=O)c2ccc(I)cc2)cc1Br |
| InChI | InChI=1S/C16H15BrINO3S2/c1-22-15-7-2-11(10-14(15)17)16-19(8-9-23-16)24(20,21)13-5-3-12(18)4-6-13/h2-7,10,16H,8-9H2,1H3/t16-/m1/s1 |
| InChIKey | JWBGUEXTWGWMFH-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|