C20H24BrNO4S2 — CID 40837370
(2S)-2-(3-bromo-4-methoxyphenyl)-3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 40837370) has the molecular formula C20H24BrNO4S2 and a molecular weight of 486.45 g/mol. Its IUPAC name is (2S)-2-(3-bromo-4-methoxyphenyl)-3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2S)-2-(3-bromo-4-methoxyphenyl)-3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 40837370 |
| Molecular Formula | C20H24BrNO4S2 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | (2S)-2-(3-bromo-4-methoxyphenyl)-3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCS[C@H]2c2ccc(OC)c(Br)c2)cc1 |
| InChI | InChI=1S/C20H24BrNO4S2/c1-3-4-12-26-16-6-8-17(9-7-16)28(23,24)22-11-13-27-20(22)15-5-10-19(25-2)18(21)14-15/h5-10,14,20H,3-4,11-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | NGCZCKQESUPKIG-FQEVSTJZSA-N |
| XLogP | 5.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|