C16H14ClN3O6S2 — CID 45076759
2-(3-chlorophenyl)-3-(4-methyl-3,5-dinitrophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 45076759) has the molecular formula C16H14ClN3O6S2 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-(4-methyl-3,5-dinitrophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(3-chlorophenyl)-3-(4-methyl-3,5-dinitrophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 45076759 |
| Molecular Formula | C16H14ClN3O6S2 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2-(3-chlorophenyl)-3-(4-methyl-3,5-dinitrophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)N2CCSC2c2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14ClN3O6S2/c1-10-14(19(21)22)8-13(9-15(10)20(23)24)28(25,26)18-5-6-27-16(18)11-3-2-4-12(17)7-11/h2-4,7-9,16H,5-6H2,1H3 |
| InChIKey | ZSMNHWJTKRNTNP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|