C17H18N2O5S2 — CID 1104663
(2R)-2-(4-methoxy-3-nitrophenyl)-3-(3-methylphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 1104663) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (2R)-2-(4-methoxy-3-nitrophenyl)-3-(3-methylphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | (2R)-2-(4-methoxy-3-nitrophenyl)-3-(3-methylphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 1104663 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (2R)-2-(4-methoxy-3-nitrophenyl)-3-(3-methylphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc([C@H]2SCCN2S(=O)(=O)c2cccc(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O5S2/c1-12-4-3-5-14(10-12)26(22,23)18-8-9-25-17(18)13-6-7-16(24-2)15(11-13)19(20)21/h3-7,10-11,17H,8-9H2,1-2H3/t17-/m1/s1 |
| InChIKey | PQYLPVBWFBDCET-QGZVFWFLSA-N |
| XLogP | 3.35 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|