C22H20N2O5S2 — CID 45076731
3-(1,2-dihydroacenaphthylen-5-ylsulfonyl)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine (PubChem CID 45076731) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-(1,2-dihydroacenaphthylen-5-ylsulfonyl)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine.
| Compound Name | 3-(1,2-dihydroacenaphthylen-5-ylsulfonyl)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 45076731 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 3-(1,2-dihydroacenaphthylen-5-ylsulfonyl)-2-(4-methoxy-3-nitrophenyl)-1,3-thiazolidine |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2ccc3c4c(cccc24)CC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20N2O5S2/c1-29-19-9-7-16(13-18(19)24(25)26)22-23(11-12-30-22)31(27,28)20-10-8-15-6-5-14-3-2-4-17(20)21(14)15/h2-4,7-10,13,22H,5-6,11-12H2,1H3 |
| InChIKey | WOBWUNMZMORQEI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|