C16H15N3O7S2 — CID 45076749
2-(4-methoxy-3-nitrophenyl)-3-(3-nitrophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 45076749) has the molecular formula C16H15N3O7S2 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-(4-methoxy-3-nitrophenyl)-3-(3-nitrophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(4-methoxy-3-nitrophenyl)-3-(3-nitrophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 45076749 |
| Molecular Formula | C16H15N3O7S2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-(4-methoxy-3-nitrophenyl)-3-(3-nitrophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N3O7S2/c1-26-15-6-5-11(9-14(15)19(22)23)16-17(7-8-27-16)28(24,25)13-4-2-3-12(10-13)18(20)21/h2-6,9-10,16H,7-8H2,1H3 |
| InChIKey | OZQURVRORNKJFY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|