C21H17ClN2O4S2 — CID 1118526
(2S)-2-(4-chloro-3-nitrophenyl)-3-(1,2-dihydroacenaphthylen-3-ylsulfonyl)-1,3-thiazolidine (PubChem CID 1118526) has the molecular formula C21H17ClN2O4S2 and a molecular weight of 460.96 g/mol. Its IUPAC name is (2S)-2-(4-chloro-3-nitrophenyl)-3-(1,2-dihydroacenaphthylen-3-ylsulfonyl)-1,3-thiazolidine.
| Compound Name | (2S)-2-(4-chloro-3-nitrophenyl)-3-(1,2-dihydroacenaphthylen-3-ylsulfonyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 1118526 |
| Molecular Formula | C21H17ClN2O4S2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | (2S)-2-(4-chloro-3-nitrophenyl)-3-(1,2-dihydroacenaphthylen-3-ylsulfonyl)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1cc([C@@H]2SCCN2S(=O)(=O)c2ccc3cccc4c3c2CC4)ccc1Cl |
| InChI | InChI=1S/C21H17ClN2O4S2/c22-17-8-5-15(12-18(17)24(25)26)21-23(10-11-29-21)30(27,28)19-9-6-14-3-1-2-13-4-7-16(19)20(13)14/h1-3,5-6,8-9,12,21H,4,7,10-11H2/t21-/m0/s1 |
| InChIKey | KBTLVKZUCZYPAQ-NRFANRHFSA-N |
| XLogP | 4.94 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|