C15H13ClN2O4S2 — CID 1118518
(2S)-3-(benzenesulfonyl)-2-(4-chloro-3-nitrophenyl)-1,3-thiazolidine (PubChem CID 1118518) has the molecular formula C15H13ClN2O4S2 and a molecular weight of 384.87 g/mol. Its IUPAC name is (2S)-3-(benzenesulfonyl)-2-(4-chloro-3-nitrophenyl)-1,3-thiazolidine.
| Compound Name | (2S)-3-(benzenesulfonyl)-2-(4-chloro-3-nitrophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 1118518 |
| Molecular Formula | C15H13ClN2O4S2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | (2S)-3-(benzenesulfonyl)-2-(4-chloro-3-nitrophenyl)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1cc([C@@H]2SCCN2S(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C15H13ClN2O4S2/c16-13-7-6-11(10-14(13)18(19)20)15-17(8-9-23-15)24(21,22)12-4-2-1-3-5-12/h1-7,10,15H,8-9H2/t15-/m0/s1 |
| InChIKey | UZZKEWSHKCWTBX-HNNXBMFYSA-N |
| XLogP | 3.68 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|