C21H17Cl2NO2S2 — CID 23945588
2-(2,4-dichlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 23945588) has the molecular formula C21H17Cl2NO2S2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 23945588 |
| Molecular Formula | C21H17Cl2NO2S2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(4-phenylphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc(-c2ccccc2)cc1)N1CCSC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl2NO2S2/c22-17-8-11-19(20(23)14-17)21-24(12-13-27-21)28(25,26)18-9-6-16(7-10-18)15-4-2-1-3-5-15/h1-11,14,21H,12-13H2 |
| InChIKey | SNPUQJUNIWYUGB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |