C22H19NO2S2 — CID 11842232
3-(9H-fluoren-3-ylsulfonyl)-2-phenyl-1,3-thiazolidine (PubChem CID 11842232) has the molecular formula C22H19NO2S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 3-(9H-fluoren-3-ylsulfonyl)-2-phenyl-1,3-thiazolidine.
| Compound Name | 3-(9H-fluoren-3-ylsulfonyl)-2-phenyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 11842232 |
| Molecular Formula | C22H19NO2S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-(9H-fluoren-3-ylsulfonyl)-2-phenyl-1,3-thiazolidine |
| SMILES | O=S(=O)(c1ccc2c(c1)-c1ccccc1C2)N1CCSC1c1ccccc1 |
| InChI | InChI=1S/C22H19NO2S2/c24-27(25,23-12-13-26-22(23)16-6-2-1-3-7-16)19-11-10-18-14-17-8-4-5-9-20(17)21(18)15-19/h1-11,15,22H,12-14H2 |
| InChIKey | WZJLZGKZNABKIE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |