C21H22N2O6S2 — CID 122345796
1-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione (PubChem CID 122345796) has the molecular formula C21H22N2O6S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 122345796 |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 1-[4-[[2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]phenyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2ccc(N3C(=O)CCC3=O)cc2)cc1OC |
| InChI | InChI=1S/C21H22N2O6S2/c1-28-17-8-3-14(13-18(17)29-2)21-22(11-12-30-21)31(26,27)16-6-4-15(5-7-16)23-19(24)9-10-20(23)25/h3-8,13,21H,9-12H2,1-2H3 |
| InChIKey | XXSJXSVBSROQCN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|