C16H16FNO3S2 — CID 3144179
3-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-1,3-thiazolidine (PubChem CID 3144179) has the molecular formula C16H16FNO3S2 and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-1,3-thiazolidine.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 3144179 |
| Molecular Formula | C16H16FNO3S2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-2-(2-methoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1ccccc1C1SCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FNO3S2/c1-21-15-5-3-2-4-14(15)16-18(10-11-22-16)23(19,20)13-8-6-12(17)7-9-13/h2-9,16H,10-11H2,1H3 |
| InChIKey | UJIGSVOOACEGCU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |