C18H20BrNO5S2 — CID 1279279
(2S)-3-(4-bromophenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine (PubChem CID 1279279) has the molecular formula C18H20BrNO5S2 and a molecular weight of 474.40 g/mol. Its IUPAC name is (2S)-3-(4-bromophenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine.
| Compound Name | (2S)-3-(4-bromophenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 1279279 |
| Molecular Formula | C18H20BrNO5S2 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | (2S)-3-(4-bromophenyl)sulfonyl-2-(2,4,5-trimethoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1cc(OC)c([C@@H]2SCCN2S(=O)(=O)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C18H20BrNO5S2/c1-23-15-11-17(25-3)16(24-2)10-14(15)18-20(8-9-26-18)27(21,22)13-6-4-12(19)5-7-13/h4-7,10-11,18H,8-9H2,1-3H3/t18-/m0/s1 |
| InChIKey | RKYBUKZVVBAJFX-SFHVURJKSA-N |
| XLogP | 3.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |