C16H15BrClNO3S2 — CID 3123287
2-(5-bromo-2-methoxyphenyl)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 3123287) has the molecular formula C16H15BrClNO3S2 and a molecular weight of 448.79 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 3123287 |
| Molecular Formula | C16H15BrClNO3S2 |
| Molecular Weight | 448.79 g/mol |
| Exact Mass | 446.94 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-3-(4-chlorophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(Br)cc1C1SCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15BrClNO3S2/c1-22-15-7-2-11(17)10-14(15)16-19(8-9-23-16)24(20,21)13-5-3-12(18)4-6-13/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | BDQWSLMYLHYUMW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |