C16H15BrN2O5S2 — CID 2859017
2-(5-bromo-2-methoxyphenyl)-3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine (PubChem CID 2859017) has the molecular formula C16H15BrN2O5S2 and a molecular weight of 459.34 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 2859017 |
| Molecular Formula | C16H15BrN2O5S2 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(Br)cc1C1SCCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15BrN2O5S2/c1-24-15-7-2-11(17)10-14(15)16-18(8-9-25-16)26(22,23)13-5-3-12(4-6-13)19(20)21/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | MELSVEDPZJGONY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|