C18H21NO4S2 — CID 3144172
2-(2,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine (PubChem CID 3144172) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine.
| Compound Name | 2-(2,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 3144172 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-3-(4-methylphenyl)sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(OC)c(C2SCCN2S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H21NO4S2/c1-13-4-7-15(8-5-13)25(20,21)19-10-11-24-18(19)16-12-14(22-2)6-9-17(16)23-3/h4-9,12,18H,10-11H2,1-3H3 |
| InChIKey | ULWRYKWHWLQVHU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |