C19H22N2O6S2 — CID 122330364
5-[[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]-2-methoxybenzamide (PubChem CID 122330364) has the molecular formula C19H22N2O6S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 5-[[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]-2-methoxybenzamide.
| Compound Name | 5-[[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 122330364 |
| Molecular Formula | C19H22N2O6S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 5-[[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl]sulfonyl]-2-methoxybenzamide |
| SMILES | COc1ccc(OC)c(C2SCCN2S(=O)(=O)c2ccc(OC)c(C(N)=O)c2)c1 |
| InChI | InChI=1S/C19H22N2O6S2/c1-25-12-4-6-17(27-3)15(10-12)19-21(8-9-28-19)29(23,24)13-5-7-16(26-2)14(11-13)18(20)22/h4-7,10-11,19H,8-9H2,1-3H3,(H2,20,22) |
| InChIKey | VAHFBLPNWNPQNP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |